C6H12N2O3 — CID 144895725
N-(ethoxymethyl)-2-formamidoacetamide (PubChem CID 144895725) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is N-(ethoxymethyl)-2-formamidoacetamide.
| Compound Name | N-(ethoxymethyl)-2-formamidoacetamide |
|---|---|
| PubChem CID | 144895725 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N-(ethoxymethyl)-2-formamidoacetamide |
| SMILES | CCOCNC(=O)CNC=O |
| InChI | InChI=1S/C6H12N2O3/c1-2-11-5-8-6(10)3-7-4-9/h4H,2-3,5H2,1H3,(H,7,9)(H,8,10) |
| InChIKey | QDDOKZRCIYAHOS-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|