About N-(2-oxopentyl)formamide
N-(2-oxopentyl)formamide (PubChem CID 57147830) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is N-(2-oxopentyl)formamide.
Molecular Properties
| Compound Name | N-(2-oxopentyl)formamide |
| PubChem CID | 57147830 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | N-(2-oxopentyl)formamide |
| SMILES | CCCC(=O)CNC=O |
| InChI | InChI=1S/C6H11NO2/c1-2-3-6(9)4-7-5-8/h5H,2-4H2,1H3,(H,7,8) |
| InChIKey | ZVEHCRKLOVGYOE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxopentyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxopentyl)formamide?
The IUPAC name of N-(2-oxopentyl)formamide (CID 57147830) is N-(2-oxopentyl)formamide.
What is the SMILES notation for N-(2-oxopentyl)formamide?
The canonical SMILES for N-(2-oxopentyl)formamide is CCCC(=O)CNC=O.
What is the InChIKey of N-(2-oxopentyl)formamide?
The InChIKey is ZVEHCRKLOVGYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-2-3-6(9)4-7-5-8/h5H,2-4H2,1H3,(H,7,8).
What are the key properties of N-(2-oxopentyl)formamide?
N-(2-oxopentyl)formamide has a molecular weight of 129.16 g/mol, XLogP of 0.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxopentyl)formamide is sourced from PubChem (CID 57147830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).