C5H10N2O2 — CID 14481878
N-ethyl-2-formamidoacetamide (PubChem CID 14481878) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is N-ethyl-2-formamidoacetamide.
| Compound Name | N-ethyl-2-formamidoacetamide |
|---|---|
| PubChem CID | 14481878 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | N-ethyl-2-formamidoacetamide |
| SMILES | CCNC(=O)CNC=O |
| InChI | InChI=1S/C5H10N2O2/c1-2-7-5(9)3-6-4-8/h4H,2-3H2,1H3,(H,6,8)(H,7,9) |
| InChIKey | JCGOEJRRNXEHCD-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|