C5H11N2O2P — CID 156853608
N-ethyl-2-(phosphanylcarbonylamino)acetamide (PubChem CID 156853608) has the molecular formula C5H11N2O2P and a molecular weight of 162.13 g/mol. Its IUPAC name is N-ethyl-2-(phosphanylcarbonylamino)acetamide.
| Compound Name | N-ethyl-2-(phosphanylcarbonylamino)acetamide |
|---|---|
| PubChem CID | 156853608 |
| Molecular Formula | C5H11N2O2P |
| Molecular Weight | 162.13 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | N-ethyl-2-(phosphanylcarbonylamino)acetamide |
| SMILES | CCNC(=O)CNC(=O)P |
| InChI | InChI=1S/C5H11N2O2P/c1-2-6-4(8)3-7-5(9)10/h2-3,10H2,1H3,(H,6,8)(H,7,9) |
| InChIKey | MEAPFSAPVXDCOT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|