C5H7N3O2 — CID 143975878
N-(cyanomethyl)-2-formamidoacetamide (PubChem CID 143975878) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is N-(cyanomethyl)-2-formamidoacetamide.
| Compound Name | N-(cyanomethyl)-2-formamidoacetamide |
|---|---|
| PubChem CID | 143975878 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | N-(cyanomethyl)-2-formamidoacetamide |
| SMILES | N#CCNC(=O)CNC=O |
| InChI | InChI=1S/C5H7N3O2/c6-1-2-8-5(10)3-7-4-9/h4H,2-3H2,(H,7,9)(H,8,10) |
| InChIKey | IIDMXRDLMQQWTI-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|