C8H15N3O4 — CID 177180356
2-[[(2-formamidoacetyl)amino]methoxy]-N-methylpropanamide (PubChem CID 177180356) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-[[(2-formamidoacetyl)amino]methoxy]-N-methylpropanamide.
| Compound Name | 2-[[(2-formamidoacetyl)amino]methoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 177180356 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-[[(2-formamidoacetyl)amino]methoxy]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)OCNC(=O)CNC=O |
| InChI | InChI=1S/C8H15N3O4/c1-6(8(14)9-2)15-5-11-7(13)3-10-4-12/h4,6H,3,5H2,1-2H3,(H,9,14)(H,10,12)(H,11,13) |
| InChIKey | HYILADKUOAIWNF-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|