C6H11NO4 — CID 143800361
N-hydroxy-2-(3-oxopropoxy)propanamide (PubChem CID 143800361) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is N-hydroxy-2-(3-oxopropoxy)propanamide.
| Compound Name | N-hydroxy-2-(3-oxopropoxy)propanamide |
|---|---|
| PubChem CID | 143800361 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | N-hydroxy-2-(3-oxopropoxy)propanamide |
| SMILES | CC(OCCC=O)C(=O)NO |
| InChI | InChI=1S/C6H11NO4/c1-5(6(9)7-10)11-4-2-3-8/h3,5,10H,2,4H2,1H3,(H,7,9) |
| InChIKey | MZKSJNBXDUQAFZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|