About 2-bromo-N'-methylacetohydrazide
2-bromo-N'-methylacetohydrazide (PubChem CID 118150932) has the molecular formula C3H7BrN2O
and a molecular weight of 167.01 g/mol. Its IUPAC name is 2-bromo-N'-methylacetohydrazide.
Molecular Properties
| Compound Name | 2-bromo-N'-methylacetohydrazide |
| PubChem CID | 118150932 |
| Molecular Formula | C3H7BrN2O |
| Molecular Weight | 167.01 g/mol |
| Exact Mass | 165.97 |
| IUPAC Name | 2-bromo-N'-methylacetohydrazide |
| SMILES | CNNC(=O)CBr |
| InChI | InChI=1S/C3H7BrN2O/c1-5-6-3(7)2-4/h5H,2H2,1H3,(H,6,7) |
| InChIKey | FJIBFBQXFABVFK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.01 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N'-methylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N'-methylacetohydrazide?
The IUPAC name of 2-bromo-N'-methylacetohydrazide (CID 118150932) is 2-bromo-N'-methylacetohydrazide.
What is the SMILES notation for 2-bromo-N'-methylacetohydrazide?
The canonical SMILES for 2-bromo-N'-methylacetohydrazide is CNNC(=O)CBr.
What is the InChIKey of 2-bromo-N'-methylacetohydrazide?
The InChIKey is FJIBFBQXFABVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BrN2O/c1-5-6-3(7)2-4/h5H,2H2,1H3,(H,6,7).
What are the key properties of 2-bromo-N'-methylacetohydrazide?
2-bromo-N'-methylacetohydrazide has a molecular weight of 167.01 g/mol, XLogP of -0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N'-methylacetohydrazide is sourced from PubChem (CID 118150932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).