C8H11N — CID 155328555
(3Z)-N-prop-2-ynylpenta-1,3-dien-2-amine (PubChem CID 155328555) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (3Z)-N-prop-2-ynylpenta-1,3-dien-2-amine.
| Compound Name | (3Z)-N-prop-2-ynylpenta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 155328555 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (3Z)-N-prop-2-ynylpenta-1,3-dien-2-amine |
| SMILES | C#CCNC(=C)/C=C\C |
| InChI | InChI=1S/C8H11N/c1-4-6-8(3)9-7-5-2/h2,4,6,9H,3,7H2,1H3/b6-4- |
| InChIKey | SFDIMMPEDFLXCX-XQRVVYSFSA-N |
| XLogP | 1.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|