C12H18 — CID 145005025
ethane;(3Z,5E)-6-ethylocta-1,3,5-trien-7-yne (PubChem CID 145005025) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is ethane;(3Z,5E)-6-ethylocta-1,3,5-trien-7-yne.
| Compound Name | ethane;(3Z,5E)-6-ethylocta-1,3,5-trien-7-yne |
|---|---|
| PubChem CID | 145005025 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | ethane;(3Z,5E)-6-ethylocta-1,3,5-trien-7-yne |
| SMILES | C#C/C(=C/C=C\C=C)CC.CC |
| InChI | InChI=1S/C10H12.C2H6/c1-4-7-8-9-10(5-2)6-3;1-2/h2,4,7-9H,1,6H2,3H3;1-2H3/b8-7-,10-9-; |
| InChIKey | PGYOFQNLIIQWGA-CGGPWJJTSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|