C9H12 — CID 123484500
4-ethylhepta-1,3-dien-5-yne (PubChem CID 123484500) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 4-ethylhepta-1,3-dien-5-yne.
| Compound Name | 4-ethylhepta-1,3-dien-5-yne |
|---|---|
| PubChem CID | 123484500 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 4-ethylhepta-1,3-dien-5-yne |
| SMILES | C=CC=C(C#CC)CC |
| InChI | InChI=1S/C9H12/c1-4-7-9(6-3)8-5-2/h4,7H,1,6H2,2-3H3 |
| InChIKey | YJGFAEUYPCFLNV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|