C12H16 — CID 143502178
(3E,5E)-6-methyl-4-prop-1-ynylocta-1,3,5-triene (PubChem CID 143502178) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (3E,5E)-6-methyl-4-prop-1-ynylocta-1,3,5-triene.
| Compound Name | (3E,5E)-6-methyl-4-prop-1-ynylocta-1,3,5-triene |
|---|---|
| PubChem CID | 143502178 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (3E,5E)-6-methyl-4-prop-1-ynylocta-1,3,5-triene |
| SMILES | C=C/C=C(C#CC)\C=C(/C)CC |
| InChI | InChI=1S/C12H16/c1-5-8-12(9-6-2)10-11(4)7-3/h5,8,10H,1,7H2,2-4H3/b11-10+,12-8- |
| InChIKey | OPVWAKLLMJQACX-LMWGADSXSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|