C18H25F — CID 166676036
(3E,7Z,8E)-3-ethyl-4-fluoro-2,9-dimethyl-7-prop-2-enylideneundeca-1,3,5,8-tetraene (PubChem CID 166676036) has the molecular formula C18H25F and a molecular weight of 260.40 g/mol. Its IUPAC name is (3E,7Z,8E)-3-ethyl-4-fluoro-2,9-dimethyl-7-prop-2-enylideneundeca-1,3,5,8-tetraene.
| Compound Name | (3E,7Z,8E)-3-ethyl-4-fluoro-2,9-dimethyl-7-prop-2-enylideneundeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 166676036 |
| Molecular Formula | C18H25F |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (3E,7Z,8E)-3-ethyl-4-fluoro-2,9-dimethyl-7-prop-2-enylideneundeca-1,3,5,8-tetraene |
| SMILES | C=C/C=C(C=C/C(F)=C(/CC)C(=C)C)\C=C(/C)CC |
| InChI | InChI=1S/C18H25F/c1-7-10-16(13-15(6)8-2)11-12-18(19)17(9-3)14(4)5/h7,10-13H,1,4,8-9H2,2-3,5-6H3/b12-11?,15-13+,16-10-,18-17+ |
| InChIKey | NJPDZXTWTWBEQY-LKPGRRBVSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|