C11H10 — CID 53381529
(3Z,5E)-4-prop-1-ynylocta-1,3,5-trien-7-yne (PubChem CID 53381529) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is (3Z,5E)-4-prop-1-ynylocta-1,3,5-trien-7-yne.
| Compound Name | (3Z,5E)-4-prop-1-ynylocta-1,3,5-trien-7-yne |
|---|---|
| PubChem CID | 53381529 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (3Z,5E)-4-prop-1-ynylocta-1,3,5-trien-7-yne |
| SMILES | C#C/C=C/C(C#CC)=C/C=C |
| InChI | InChI=1S/C11H10/c1-4-7-10-11(8-5-2)9-6-3/h1,5,7-8,10H,2H2,3H3/b10-7+,11-8+ |
| InChIKey | UWWMSSCQDBCPJJ-AMMQDNIMSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|