C11H14 — CID 143197303
(3Z,6Z)-5-propan-2-ylideneocta-3,6-dien-1-yne (PubChem CID 143197303) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (3Z,6Z)-5-propan-2-ylideneocta-3,6-dien-1-yne.
| Compound Name | (3Z,6Z)-5-propan-2-ylideneocta-3,6-dien-1-yne |
|---|---|
| PubChem CID | 143197303 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3Z,6Z)-5-propan-2-ylideneocta-3,6-dien-1-yne |
| SMILES | C#C/C=C\C(/C=C\C)=C(C)C |
| InChI | InChI=1S/C11H14/c1-5-7-9-11(8-6-2)10(3)4/h1,6-9H,2-4H3/b8-6-,9-7- |
| InChIKey | OXMGQMLVGFPLLY-VRHVFUOLSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|