C10H13NO — CID 130282853
(Z,2E)-N-ethyl-2-ethylidenehex-3-en-5-ynamide (PubChem CID 130282853) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (Z,2E)-N-ethyl-2-ethylidenehex-3-en-5-ynamide.
| Compound Name | (Z,2E)-N-ethyl-2-ethylidenehex-3-en-5-ynamide |
|---|---|
| PubChem CID | 130282853 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (Z,2E)-N-ethyl-2-ethylidenehex-3-en-5-ynamide |
| SMILES | C#C/C=C\C(=C/C)C(=O)NCC |
| InChI | InChI=1S/C10H13NO/c1-4-7-8-9(5-2)10(12)11-6-3/h1,5,7-8H,6H2,2-3H3,(H,11,12)/b8-7-,9-5+ |
| InChIKey | GUNBZKSWKOLIHO-ISXYNVPDSA-N |
| XLogP | 1.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|