C11H21NO2 — CID 142274117
ethane;(E,2E)-N-ethyl-2-ethylidene-3-hydroxypent-3-enamide (PubChem CID 142274117) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is ethane;(E,2E)-N-ethyl-2-ethylidene-3-hydroxypent-3-enamide.
| Compound Name | ethane;(E,2E)-N-ethyl-2-ethylidene-3-hydroxypent-3-enamide |
|---|---|
| PubChem CID | 142274117 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethane;(E,2E)-N-ethyl-2-ethylidene-3-hydroxypent-3-enamide |
| SMILES | C/C=C(O)\C(=C/C)C(=O)NCC.CC |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-4-7(8(11)5-2)9(12)10-6-3;1-2/h4-5,11H,6H2,1-3H3,(H,10,12);1-2H3/b7-4+,8-5+; |
| InChIKey | BOXAWYQWHXRAGP-JJHSXXHRSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|