C5H9NO4 — CID 161274596
N-ethyl-2,3,3-trihydroxyprop-2-enamide (PubChem CID 161274596) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is N-ethyl-2,3,3-trihydroxyprop-2-enamide.
| Compound Name | N-ethyl-2,3,3-trihydroxyprop-2-enamide |
|---|---|
| PubChem CID | 161274596 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | N-ethyl-2,3,3-trihydroxyprop-2-enamide |
| SMILES | CCNC(=O)C(O)=C(O)O |
| InChI | InChI=1S/C5H9NO4/c1-2-6-4(8)3(7)5(9)10/h7,9-10H,2H2,1H3,(H,6,8) |
| InChIKey | VEGOZORZRZBXGX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|