C4H10N4O4 — CID 174658040
N-ethyl-N',N'-bis(hydroxyamino)oxamide (PubChem CID 174658040) has the molecular formula C4H10N4O4 and a molecular weight of 178.15 g/mol. Its IUPAC name is N-ethyl-N',N'-bis(hydroxyamino)oxamide.
| Compound Name | N-ethyl-N',N'-bis(hydroxyamino)oxamide |
|---|---|
| PubChem CID | 174658040 |
| Molecular Formula | C4H10N4O4 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N-ethyl-N',N'-bis(hydroxyamino)oxamide |
| SMILES | CCNC(=O)C(=O)N(NO)NO |
| InChI | InChI=1S/C4H10N4O4/c1-2-5-3(9)4(10)8(6-11)7-12/h6-7,11-12H,2H2,1H3,(H,5,9) |
| InChIKey | JGHYWUKHCDBKHA-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|