C9H16N2O — CID 118029945
(Z,2E)-N-(aminomethyl)-2-ethylidenehex-3-enamide (PubChem CID 118029945) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (Z,2E)-N-(aminomethyl)-2-ethylidenehex-3-enamide.
| Compound Name | (Z,2E)-N-(aminomethyl)-2-ethylidenehex-3-enamide |
|---|---|
| PubChem CID | 118029945 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (Z,2E)-N-(aminomethyl)-2-ethylidenehex-3-enamide |
| SMILES | C/C=C(\C=C/CC)C(=O)NCN |
| InChI | InChI=1S/C9H16N2O/c1-3-5-6-8(4-2)9(12)11-7-10/h4-6H,3,7,10H2,1-2H3,(H,11,12)/b6-5-,8-4+ |
| InChIKey | BIIQDULMEQZESV-QNMAEOQASA-N |
| XLogP | 0.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|