C14H23NO — CID 143257008
(2E,3Z,5Z)-5-ethyl-2-ethylidene-N-propylhepta-3,5-dienamide (PubChem CID 143257008) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2E,3Z,5Z)-5-ethyl-2-ethylidene-N-propylhepta-3,5-dienamide.
| Compound Name | (2E,3Z,5Z)-5-ethyl-2-ethylidene-N-propylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 143257008 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2E,3Z,5Z)-5-ethyl-2-ethylidene-N-propylhepta-3,5-dienamide |
| SMILES | C/C=C(\C=C/C(=C\C)C(=O)NCCC)CC |
| InChI | InChI=1S/C14H23NO/c1-5-11-15-14(16)13(8-4)10-9-12(6-2)7-3/h6,8-10H,5,7,11H2,1-4H3,(H,15,16)/b10-9-,12-6-,13-8+ |
| InChIKey | NNIWSIZTCNVMJA-QOKLPFDUSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|