C10H16OS2 — CID 142608839
S-(2-sulfanylethyl) (Z,2E)-2-ethylidenehex-3-enethioate (PubChem CID 142608839) has the molecular formula C10H16OS2 and a molecular weight of 216.37 g/mol. Its IUPAC name is S-(2-sulfanylethyl) (Z,2E)-2-ethylidenehex-3-enethioate.
| Compound Name | S-(2-sulfanylethyl) (Z,2E)-2-ethylidenehex-3-enethioate |
|---|---|
| PubChem CID | 142608839 |
| Molecular Formula | C10H16OS2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | S-(2-sulfanylethyl) (Z,2E)-2-ethylidenehex-3-enethioate |
| SMILES | C/C=C(\C=C/CC)C(=O)SCCS |
| InChI | InChI=1S/C10H16OS2/c1-3-5-6-9(4-2)10(11)13-8-7-12/h4-6,12H,3,7-8H2,1-2H3/b6-5-,9-4+ |
| InChIKey | ZDDRFYADIOIQIQ-CXBDEZGUSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|