C15H21NO — CID 143063008
N-[(Z)-but-2-en-2-yl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]propan-2-imine (PubChem CID 143063008) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]propan-2-imine.
| Compound Name | N-[(Z)-but-2-en-2-yl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]propan-2-imine |
|---|---|
| PubChem CID | 143063008 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]propan-2-imine |
| SMILES | C#C/C=C\C(=C/C)COC/C(C)=N/C(C)=C\C |
| InChI | InChI=1S/C15H21NO/c1-6-9-10-15(8-3)12-17-11-14(5)16-13(4)7-2/h1,7-10H,11-12H2,2-5H3/b10-9-,13-7-,15-8+,16-14+ |
| InChIKey | HXAPSFJYGKOZHP-GPGSIUABSA-N |
| XLogP | 3.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|