C16H19NO6 — CID 155257616
(2R,3S)-2-(carboxymethyl)-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]carbonyl-3-methylazetidine-2-carboxylic acid (PubChem CID 155257616) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2R,3S)-2-(carboxymethyl)-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]carbonyl-3-methylazetidine-2-carboxylic acid.
| Compound Name | (2R,3S)-2-(carboxymethyl)-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]carbonyl-3-methylazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155257616 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2R,3S)-2-(carboxymethyl)-1-[(Z,2E)-2-ethylidenehex-3-en-5-ynoxy]carbonyl-3-methylazetidine-2-carboxylic acid |
| SMILES | C#C/C=C\C(=C/C)COC(=O)N1C[C@H](C)[C@]1(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H19NO6/c1-4-6-7-12(5-2)10-23-15(22)17-9-11(3)16(17,14(20)21)8-13(18)19/h1,5-7,11H,8-10H2,2-3H3,(H,18,19)(H,20,21)/b7-6-,12-5+/t11-,16+/m0/s1 |
| InChIKey | TWZZMFXXMIEXRB-DCGRFHGGSA-N |
| XLogP | 1.51 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|