2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid

C10H19NO3 — CID 83908396

IUPAC2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid
SMILESCC1CN(C)CC(C)C1(O)CC(=O)O
InChIInChI=1S/C10H19NO3/c1-7-5-11(3)6-8(2)10(7,14)4-9(12)13/h7-8,14H,4-6H2,1-3H3,(H,12,13)
InChIKeyLZYYFFMEXOHRCD-UHFFFAOYSA-N
MW201.27 g/mol
LogP0.41
Rot. Bonds2

About 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid

2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid (PubChem CID 83908396) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid
PubChem CID83908396
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid
SMILESCC1CN(C)CC(C)C1(O)CC(=O)O
InChIInChI=1S/C10H19NO3/c1-7-5-11(3)6-8(2)10(7,14)4-9(12)13/h7-8,14H,4-6H2,1-3H3,(H,12,13)
InChIKeyLZYYFFMEXOHRCD-UHFFFAOYSA-N
XLogP0.41
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid (CID 83908396) is 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid is CC1CN(C)CC(C)C1(O)CC(=O)O.
What is the InChIKey of 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid?
The InChIKey is LZYYFFMEXOHRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-7-5-11(3)6-8(2)10(7,14)4-9(12)13/h7-8,14H,4-6H2,1-3H3,(H,12,13).
What are the key properties of 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid?
2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid has a molecular weight of 201.27 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-1,3,5-trimethylpiperidin-4-yl)acetic acid is sourced from PubChem (CID 83908396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).