C9H11N — CID 145179065
(3Z)-5-methylideneocta-1,3-dien-6-yn-2-amine (PubChem CID 145179065) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is (3Z)-5-methylideneocta-1,3-dien-6-yn-2-amine.
| Compound Name | (3Z)-5-methylideneocta-1,3-dien-6-yn-2-amine |
|---|---|
| PubChem CID | 145179065 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (3Z)-5-methylideneocta-1,3-dien-6-yn-2-amine |
| SMILES | C=C(N)/C=C\C(=C)C#CC |
| InChI | InChI=1S/C9H11N/c1-4-5-8(2)6-7-9(3)10/h6-7H,2-3,10H2,1H3/b7-6- |
| InChIKey | LQISWJHQYVWIRB-SREVYHEPSA-N |
| XLogP | 1.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|