C19H22 — CID 145154524
(3Z,9Z)-2-methyl-5,8,11-trimethylidenepentadeca-1,3,9,14-tetraen-6-yne (PubChem CID 145154524) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is (3Z,9Z)-2-methyl-5,8,11-trimethylidenepentadeca-1,3,9,14-tetraen-6-yne.
| Compound Name | (3Z,9Z)-2-methyl-5,8,11-trimethylidenepentadeca-1,3,9,14-tetraen-6-yne |
|---|---|
| PubChem CID | 145154524 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3Z,9Z)-2-methyl-5,8,11-trimethylidenepentadeca-1,3,9,14-tetraen-6-yne |
| SMILES | C=CCCC(=C)/C=C\C(=C)C#CC(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C19H22/c1-7-8-9-17(4)12-13-19(6)15-14-18(5)11-10-16(2)3/h7,10-13H,1-2,4-6,8-9H2,3H3/b11-10-,13-12- |
| InChIKey | YFPQPPQOBDNFME-FQEMRORKSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|