About 3-methylidenehepta-1,6-dien-1-one
3-methylidenehepta-1,6-dien-1-one (PubChem CID 15935645) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3-methylidenehepta-1,6-dien-1-one.
Molecular Properties
| Compound Name | 3-methylidenehepta-1,6-dien-1-one |
| PubChem CID | 15935645 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 3-methylidenehepta-1,6-dien-1-one |
| SMILES | C=CCCC(=C)C=C=O |
| InChI | InChI=1S/C8H10O/c1-3-4-5-8(2)6-7-9/h3,6H,1-2,4-5H2 |
| InChIKey | QXHCSKLFIYBJOD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenehepta-1,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenehepta-1,6-dien-1-one?
The IUPAC name of 3-methylidenehepta-1,6-dien-1-one (CID 15935645) is 3-methylidenehepta-1,6-dien-1-one.
What is the SMILES notation for 3-methylidenehepta-1,6-dien-1-one?
The canonical SMILES for 3-methylidenehepta-1,6-dien-1-one is C=CCCC(=C)C=C=O.
What is the InChIKey of 3-methylidenehepta-1,6-dien-1-one?
The InChIKey is QXHCSKLFIYBJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-3-4-5-8(2)6-7-9/h3,6H,1-2,4-5H2.
What are the key properties of 3-methylidenehepta-1,6-dien-1-one?
3-methylidenehepta-1,6-dien-1-one has a molecular weight of 122.17 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenehepta-1,6-dien-1-one is sourced from PubChem (CID 15935645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).