About N-formylpent-4-enamide
N-formylpent-4-enamide (PubChem CID 138584202) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is N-formylpent-4-enamide.
Molecular Properties
| Compound Name | N-formylpent-4-enamide |
| PubChem CID | 138584202 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | N-formylpent-4-enamide |
| SMILES | C=CCCC(=O)NC=O |
| InChI | InChI=1S/C6H9NO2/c1-2-3-4-6(9)7-5-8/h2,5H,1,3-4H2,(H,7,8,9) |
| InChIKey | TZBHWVRZZOLPSB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-formylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formylpent-4-enamide?
The IUPAC name of N-formylpent-4-enamide (CID 138584202) is N-formylpent-4-enamide.
What is the SMILES notation for N-formylpent-4-enamide?
The canonical SMILES for N-formylpent-4-enamide is C=CCCC(=O)NC=O.
What is the InChIKey of N-formylpent-4-enamide?
The InChIKey is TZBHWVRZZOLPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-2-3-4-6(9)7-5-8/h2,5H,1,3-4H2,(H,7,8,9).
What are the key properties of N-formylpent-4-enamide?
N-formylpent-4-enamide has a molecular weight of 127.14 g/mol, XLogP of 0.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-formylpent-4-enamide is sourced from PubChem (CID 138584202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).