C13H22 — CID 153401729
ethane;(3Z)-2-methyl-5-methylidenehepta-1,3-dien-6-yne (PubChem CID 153401729) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is ethane;(3Z)-2-methyl-5-methylidenehepta-1,3-dien-6-yne.
| Compound Name | ethane;(3Z)-2-methyl-5-methylidenehepta-1,3-dien-6-yne |
|---|---|
| PubChem CID | 153401729 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | ethane;(3Z)-2-methyl-5-methylidenehepta-1,3-dien-6-yne |
| SMILES | C#CC(=C)/C=C\C(=C)C.CC.CC |
| InChI | InChI=1S/C9H10.2C2H6/c1-5-9(4)7-6-8(2)3;2*1-2/h1,6-7H,2,4H2,3H3;2*1-2H3/b7-6-;; |
| InChIKey | DSXSVDXEJBADAI-AQTVDGORSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|