C11H14 — CID 145388588
(Z)-7-methyl-3,6-dimethylideneoct-4-en-1-yne (PubChem CID 145388588) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (Z)-7-methyl-3,6-dimethylideneoct-4-en-1-yne.
| Compound Name | (Z)-7-methyl-3,6-dimethylideneoct-4-en-1-yne |
|---|---|
| PubChem CID | 145388588 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (Z)-7-methyl-3,6-dimethylideneoct-4-en-1-yne |
| SMILES | C#CC(=C)/C=C\C(=C)C(C)C |
| InChI | InChI=1S/C11H14/c1-6-10(4)7-8-11(5)9(2)3/h1,7-9H,4-5H2,2-3H3/b8-7- |
| InChIKey | ZNPSDFCHNBBRNS-FPLPWBNLSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|