C13H25Y- — CID 177140629
ethane;(3Z)-6-methyl-5-methylidenehepta-1,3-diene;yttrium (PubChem CID 177140629) has the molecular formula C13H25Y- and a molecular weight of 270.25 g/mol. Its IUPAC name is ethane;(3Z)-6-methyl-5-methylidenehepta-1,3-diene;yttrium.
| Compound Name | ethane;(3Z)-6-methyl-5-methylidenehepta-1,3-diene;yttrium |
|---|---|
| PubChem CID | 177140629 |
| Molecular Formula | C13H25Y- |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethane;(3Z)-6-methyl-5-methylidenehepta-1,3-diene;yttrium |
| SMILES | C=[C-]/C=C\C(=C)C(C)C.CC.CC.[Y] |
| InChI | InChI=1S/C9H13.2C2H6.Y/c1-5-6-7-9(4)8(2)3;2*1-2;/h6-8H,1,4H2,2-3H3;2*1-2H3;/q-1;;;/b7-6-;;; |
| InChIKey | QUDBBNLEALOGSQ-YYFHNNNUSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|