C11H19N — CID 143072241
ethane;(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-amine (PubChem CID 143072241) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-amine.
| Compound Name | ethane;(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143072241 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | ethane;(4Z)-6-methyl-3-methylidenehepta-1,4,6-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)C(=C)N.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-7(2)5-6-8(3)9(4)10;1-2/h5-6H,1,3-4,10H2,2H3;1-2H3/b6-5-; |
| InChIKey | VLOOUZIGJVNQNZ-YSMBQZINSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|