C9H12N2 — CID 88901115
N'-[(1Z)-2-methylbuta-1,3-dienyl]but-2-ynimidamide (PubChem CID 88901115) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N'-[(1Z)-2-methylbuta-1,3-dienyl]but-2-ynimidamide.
| Compound Name | N'-[(1Z)-2-methylbuta-1,3-dienyl]but-2-ynimidamide |
|---|---|
| PubChem CID | 88901115 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N'-[(1Z)-2-methylbuta-1,3-dienyl]but-2-ynimidamide |
| SMILES | C=C/C(C)=C\N=C(\N)C#CC |
| InChI | InChI=1S/C9H12N2/c1-4-6-9(10)11-7-8(3)5-2/h5,7H,2H2,1,3H3,(H2,10,11)/b8-7- |
| InChIKey | BZHCKJQULODQHM-FPLPWBNLSA-N |
| XLogP | 1.46 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|