C14H23N — CID 143076297
(3Z,8Z)-10-methyl-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-amine;molecular hydrogen (PubChem CID 143076297) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3Z,8Z)-10-methyl-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-amine;molecular hydrogen.
| Compound Name | (3Z,8Z)-10-methyl-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-amine;molecular hydrogen |
|---|---|
| PubChem CID | 143076297 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3Z,8Z)-10-methyl-5,7-dimethylideneundeca-1,3,8,10-tetraen-2-amine;molecular hydrogen |
| SMILES | C=C(C)/C=C\C(=C)CC(=C)/C=C\C(=C)N.[H][H].[H][H] |
| InChI | InChI=1S/C14H19N.2H2/c1-11(2)6-7-12(3)10-13(4)8-9-14(5)15;;/h6-9H,1,3-5,10,15H2,2H3;2*1H/b7-6-,9-8-;; |
| InChIKey | KOZXEUKOGWQGIB-ZYQZOJNJSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|