C11H15F — CID 145351240
ethane;(3E)-4-fluoro-5-methylideneocta-1,3-dien-6-yne (PubChem CID 145351240) has the molecular formula C11H15F and a molecular weight of 166.24 g/mol. Its IUPAC name is ethane;(3E)-4-fluoro-5-methylideneocta-1,3-dien-6-yne.
| Compound Name | ethane;(3E)-4-fluoro-5-methylideneocta-1,3-dien-6-yne |
|---|---|
| PubChem CID | 145351240 |
| Molecular Formula | C11H15F |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | ethane;(3E)-4-fluoro-5-methylideneocta-1,3-dien-6-yne |
| SMILES | C=C/C=C(/F)C(=C)C#CC.CC |
| InChI | InChI=1S/C9H9F.C2H6/c1-4-6-8(3)9(10)7-5-2;1-2/h5,7H,2-3H2,1H3;1-2H3/b9-7+; |
| InChIKey | IFOHFYARZDCFRR-BXTVWIJMSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|