C13H19FO — CID 89393246
(2Z,4E)-4-fluoro-3-methyl-2-(3-methylbut-3-en-2-yl)hepta-2,4,6-trien-1-ol (PubChem CID 89393246) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is (2Z,4E)-4-fluoro-3-methyl-2-(3-methylbut-3-en-2-yl)hepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4E)-4-fluoro-3-methyl-2-(3-methylbut-3-en-2-yl)hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 89393246 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2Z,4E)-4-fluoro-3-methyl-2-(3-methylbut-3-en-2-yl)hepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(F)\C(C)=C(/CO)C(C)C(=C)C |
| InChI | InChI=1S/C13H19FO/c1-6-7-13(14)11(5)12(8-15)10(4)9(2)3/h6-7,10,15H,1-2,8H2,3-5H3/b12-11+,13-7+ |
| InChIKey | HXQUCBRSQAVPGS-UBKKISCZSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|