C6H9FO — CID 170094362
(3E)-2-fluorohexa-3,5-dien-3-ol (PubChem CID 170094362) has the molecular formula C6H9FO and a molecular weight of 116.13 g/mol. Its IUPAC name is (3E)-2-fluorohexa-3,5-dien-3-ol.
| Compound Name | (3E)-2-fluorohexa-3,5-dien-3-ol |
|---|---|
| PubChem CID | 170094362 |
| Molecular Formula | C6H9FO |
| Molecular Weight | 116.13 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | (3E)-2-fluorohexa-3,5-dien-3-ol |
| SMILES | C=C/C=C(/O)C(C)F |
| InChI | InChI=1S/C6H9FO/c1-3-4-6(8)5(2)7/h3-5,8H,1H2,2H3/b6-4+ |
| InChIKey | DGIXZQIGKSBYAM-GQCTYLIASA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|