C7H8F2O — CID 143908605
(3E)-3-fluoro-2-(fluoromethoxy)hexa-1,3,5-triene (PubChem CID 143908605) has the molecular formula C7H8F2O and a molecular weight of 146.14 g/mol. Its IUPAC name is (3E)-3-fluoro-2-(fluoromethoxy)hexa-1,3,5-triene.
| Compound Name | (3E)-3-fluoro-2-(fluoromethoxy)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143908605 |
| Molecular Formula | C7H8F2O |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (3E)-3-fluoro-2-(fluoromethoxy)hexa-1,3,5-triene |
| SMILES | C=C/C=C(/F)C(=C)OCF |
| InChI | InChI=1S/C7H8F2O/c1-3-4-7(9)6(2)10-5-8/h3-4H,1-2,5H2/b7-4+ |
| InChIKey | ZGUFBIHIMPKJGT-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|