C13H16FN — CID 163300539
(3Z,7E)-7-fluoro-2,5,6-trimethylidenedeca-3,7,9-trien-1-amine (PubChem CID 163300539) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is (3Z,7E)-7-fluoro-2,5,6-trimethylidenedeca-3,7,9-trien-1-amine.
| Compound Name | (3Z,7E)-7-fluoro-2,5,6-trimethylidenedeca-3,7,9-trien-1-amine |
|---|---|
| PubChem CID | 163300539 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3Z,7E)-7-fluoro-2,5,6-trimethylidenedeca-3,7,9-trien-1-amine |
| SMILES | C=C/C=C(/F)C(=C)C(=C)/C=C/C(=C)CN |
| InChI | InChI=1S/C13H16FN/c1-5-6-13(14)12(4)11(3)8-7-10(2)9-15/h5-8H,1-4,9,15H2/b8-7-,13-6+ |
| InChIKey | HSFONLFUCNRKMT-ZUKYEBQOSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|