C11H15FO — CID 163264892
(3Z,6E)-6-fluoro-4-methyl-5-methylidenenona-3,6,8-trien-2-one;molecular hydrogen (PubChem CID 163264892) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is (3Z,6E)-6-fluoro-4-methyl-5-methylidenenona-3,6,8-trien-2-one;molecular hydrogen.
| Compound Name | (3Z,6E)-6-fluoro-4-methyl-5-methylidenenona-3,6,8-trien-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 163264892 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3Z,6E)-6-fluoro-4-methyl-5-methylidenenona-3,6,8-trien-2-one;molecular hydrogen |
| SMILES | C=C/C=C(/F)C(=C)/C(C)=C\C(C)=O.[H][H] |
| InChI | InChI=1S/C11H13FO.H2/c1-5-6-11(12)10(4)8(2)7-9(3)13;/h5-7H,1,4H2,2-3H3;1H/b8-7-,11-6+; |
| InChIKey | HZZOJZATXSOLJB-WUYYFAKCSA-N |
| XLogP | 3.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|