C9H13FO — CID 143118686
(3Z)-5-fluoro-4,6-dimethylhepta-3,5-dien-2-one (PubChem CID 143118686) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is (3Z)-5-fluoro-4,6-dimethylhepta-3,5-dien-2-one.
| Compound Name | (3Z)-5-fluoro-4,6-dimethylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 143118686 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (3Z)-5-fluoro-4,6-dimethylhepta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C(/C)C(F)=C(C)C |
| InChI | InChI=1S/C9H13FO/c1-6(2)9(10)7(3)5-8(4)11/h5H,1-4H3/b7-5- |
| InChIKey | XSMBZMAOYPOJLZ-ALCCZGGFSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|