C14H19FO — CID 154979005
(3E,7E)-4-ethyl-7-fluoro-2-methyl-6-methylidenedeca-3,7,9-trien-5-one (PubChem CID 154979005) has the molecular formula C14H19FO and a molecular weight of 222.30 g/mol. Its IUPAC name is (3E,7E)-4-ethyl-7-fluoro-2-methyl-6-methylidenedeca-3,7,9-trien-5-one.
| Compound Name | (3E,7E)-4-ethyl-7-fluoro-2-methyl-6-methylidenedeca-3,7,9-trien-5-one |
|---|---|
| PubChem CID | 154979005 |
| Molecular Formula | C14H19FO |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3E,7E)-4-ethyl-7-fluoro-2-methyl-6-methylidenedeca-3,7,9-trien-5-one |
| SMILES | C=C/C=C(/F)C(=C)C(=O)/C(=C/C(C)C)CC |
| InChI | InChI=1S/C14H19FO/c1-6-8-13(15)11(5)14(16)12(7-2)9-10(3)4/h6,8-10H,1,5,7H2,2-4H3/b12-9+,13-8+ |
| InChIKey | DQCCVMYOWOZRIB-GHEQENTPSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|