C13H21FO2 — CID 145135167
ethane;(4Z)-4-[(E)-1-fluoroprop-1-enyl]-2-methylhepta-4,6-dienoic acid (PubChem CID 145135167) has the molecular formula C13H21FO2 and a molecular weight of 228.31 g/mol. Its IUPAC name is ethane;(4Z)-4-[(E)-1-fluoroprop-1-enyl]-2-methylhepta-4,6-dienoic acid.
| Compound Name | ethane;(4Z)-4-[(E)-1-fluoroprop-1-enyl]-2-methylhepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 145135167 |
| Molecular Formula | C13H21FO2 |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethane;(4Z)-4-[(E)-1-fluoroprop-1-enyl]-2-methylhepta-4,6-dienoic acid |
| SMILES | C=C/C=C(CC(C)C(=O)O)\C(F)=C/C.CC |
| InChI | InChI=1S/C11H15FO2.C2H6/c1-4-6-9(10(12)5-2)7-8(3)11(13)14;1-2/h4-6,8H,1,7H2,2-3H3,(H,13,14);1-2H3/b9-6-,10-5+; |
| InChIKey | ZEPDJMQCLOSHDN-MHAKMCTMSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|