C14H21FO — CID 88905328
(3Z)-4-[(E)-1-fluoroprop-1-enyl]-8-methoxy-6-methyl-5-methylideneocta-1,3-diene (PubChem CID 88905328) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is (3Z)-4-[(E)-1-fluoroprop-1-enyl]-8-methoxy-6-methyl-5-methylideneocta-1,3-diene.
| Compound Name | (3Z)-4-[(E)-1-fluoroprop-1-enyl]-8-methoxy-6-methyl-5-methylideneocta-1,3-diene |
|---|---|
| PubChem CID | 88905328 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (3Z)-4-[(E)-1-fluoroprop-1-enyl]-8-methoxy-6-methyl-5-methylideneocta-1,3-diene |
| SMILES | C=C/C=C(C(=C)C(C)CCOC)\C(F)=C/C |
| InChI | InChI=1S/C14H21FO/c1-6-8-13(14(15)7-2)12(4)11(3)9-10-16-5/h6-8,11H,1,4,9-10H2,2-3,5H3/b13-8-,14-7+ |
| InChIKey | RPFLTPUGEAGZOE-MHJUWLSHSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|