azane;4-methoxy-2-methylbutanoic acid

C6H15NO3 — CID 174560200

IUPACazane;4-methoxy-2-methylbutanoic acid
SMILESCOCCC(C)C(=O)O.N
InChIInChI=1S/C6H12O3.H3N/c1-5(6(7)8)3-4-9-2;/h5H,3-4H2,1-2H3,(H,7,8);1H3
InChIKeyLVDDGRGNQNZCBV-UHFFFAOYSA-N
MW149.19 g/mol
LogP0.91
Rot. Bonds4

About azane;4-methoxy-2-methylbutanoic acid

azane;4-methoxy-2-methylbutanoic acid (PubChem CID 174560200) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is azane;4-methoxy-2-methylbutanoic acid.

Molecular Properties

Compound Nameazane;4-methoxy-2-methylbutanoic acid
PubChem CID174560200
Molecular FormulaC6H15NO3
Molecular Weight149.19 g/mol
Exact Mass149.11
IUPAC Nameazane;4-methoxy-2-methylbutanoic acid
SMILESCOCCC(C)C(=O)O.N
InChIInChI=1S/C6H12O3.H3N/c1-5(6(7)8)3-4-9-2;/h5H,3-4H2,1-2H3,(H,7,8);1H3
InChIKeyLVDDGRGNQNZCBV-UHFFFAOYSA-N
XLogP0.91
TPSA81.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.19
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze azane;4-methoxy-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;4-methoxy-2-methylbutanoic acid?
The IUPAC name of azane;4-methoxy-2-methylbutanoic acid (CID 174560200) is azane;4-methoxy-2-methylbutanoic acid.
What is the SMILES notation for azane;4-methoxy-2-methylbutanoic acid?
The canonical SMILES for azane;4-methoxy-2-methylbutanoic acid is COCCC(C)C(=O)O.N.
What is the InChIKey of azane;4-methoxy-2-methylbutanoic acid?
The InChIKey is LVDDGRGNQNZCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.H3N/c1-5(6(7)8)3-4-9-2;/h5H,3-4H2,1-2H3,(H,7,8);1H3.
What are the key properties of azane;4-methoxy-2-methylbutanoic acid?
azane;4-methoxy-2-methylbutanoic acid has a molecular weight of 149.19 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-methoxy-2-methylbutanoic acid is sourced from PubChem (CID 174560200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).