C10H21NO4 — CID 61418249
3-[bis(2-methoxyethyl)amino]-2-methylpropanoic acid (PubChem CID 61418249) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61418249 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-2-methylpropanoic acid |
| SMILES | COCCN(CCOC)CC(C)C(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-9(10(12)13)8-11(4-6-14-2)5-7-15-3/h9H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | UHTIIJRVQOVYBA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |