C11H24N2O3 — CID 63055687
2-amino-4-[2-methoxyethyl(2-methylpropyl)amino]butanoic acid (PubChem CID 63055687) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-amino-4-[2-methoxyethyl(2-methylpropyl)amino]butanoic acid.
| Compound Name | 2-amino-4-[2-methoxyethyl(2-methylpropyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63055687 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-amino-4-[2-methoxyethyl(2-methylpropyl)amino]butanoic acid |
| SMILES | COCCN(CCC(N)C(=O)O)CC(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-9(2)8-13(6-7-16-3)5-4-10(12)11(14)15/h9-10H,4-8,12H2,1-3H3,(H,14,15) |
| InChIKey | ARPQMVQACHTPQY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |