C10H19NO5 — CID 82327474
3-[carboxymethyl(3-methoxypropyl)amino]-2-methylpropanoic acid (PubChem CID 82327474) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-[carboxymethyl(3-methoxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[carboxymethyl(3-methoxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82327474 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-[carboxymethyl(3-methoxypropyl)amino]-2-methylpropanoic acid |
| SMILES | COCCCN(CC(=O)O)CC(C)C(=O)O |
| InChI | InChI=1S/C10H19NO5/c1-8(10(14)15)6-11(7-9(12)13)4-3-5-16-2/h8H,3-7H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | DZVSPNTXGGUDEM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|