C11H19NO6 — CID 82330638
3-[2-carboxyethyl(3-carboxypropyl)amino]-2-methylpropanoic acid (PubChem CID 82330638) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is 3-[2-carboxyethyl(3-carboxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[2-carboxyethyl(3-carboxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82330638 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-[2-carboxyethyl(3-carboxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CC(CN(CCCC(=O)O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19NO6/c1-8(11(17)18)7-12(6-4-10(15)16)5-2-3-9(13)14/h8H,2-7H2,1H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | PYRYXSLUNWTFRL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |